Products 2177267-69-3
CAS 2177267-69-3 is the registry number for O5-tert-butyl O3a-methyl trans-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a,5-dicarboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-O-tert-butyl 3a-O-methyl (3aS,6aR)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a,5-dicarboxylate (CAS 2177267-69-3) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 5-O-tert-butyl 3a-O-methyl (3aS,6aR)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a,5-dicarboxylate. InChIKey: SNAWNEHNZGMNAF-RNCFNFMXSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 5-O-tert-butyl 3a-O-methyl (3aS,6aR)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a,5-dicarboxylate |
| InChIKey | SNAWNEHNZGMNAF-RNCFNFMXSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2COC[C@]2(C1)C(=O)OC |
Computed by PubChem (NCBI)