Products 2177287-70-4
CAS 2177287-70-4 appears in our catalog under these names: Carfilzomib Impurity 65, tert-Butyl (R)-(2,6-dimethyl-3-oxohept-1-en-4-yl)carbamate 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
Tert-butyl N-[(4R)-2,6-dimethyl-3-oxohept-1-en-4-yl]carbamate (CAS 2177287-70-4) is a chemical compound with the molecular formula C14H25NO3 and a molecular weight of 255.35 g/mol. IUPAC name: tert-butyl N-[(4R)-2,6-dimethyl-3-oxohept-1-en-4-yl]carbamate. InChIKey: BRMIWZWAGRRHEN-LLVKDONJSA-N.
| Molecular formula | C14H25NO3 |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | tert-butyl N-[(4R)-2,6-dimethyl-3-oxohept-1-en-4-yl]carbamate |
| InChIKey | BRMIWZWAGRRHEN-LLVKDONJSA-N |
| SMILES | CC(C)C[C@H](C(=O)C(=C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)