CAS 2179087-17-1 is the registry number for (R)-Isochroman-4-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(4R)-3,4-dihydro-1H-isochromen-4-amine;hydrochloride (CAS 2179087-17-1) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: (4R)-3,4-dihydro-1H-isochromen-4-amine;hydrochloride. InChIKey: RLECIOZWNPNKKL-FVGYRXGTSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | (4R)-3,4-dihydro-1H-isochromen-4-amine;hydrochloride |
| InChIKey | RLECIOZWNPNKKL-FVGYRXGTSA-N |
| SMILES | C1[C@@H](C2=CC=CC=C2CO1)N.Cl |
Computed by PubChem (NCBI)