CAS 21816-42-2 appears in our catalog under these names: 2,5-Dimethyl-4-nitropyridine 1-oxide, 95%, 2,5–Dimethyl–4–nitropyridine 1–oxide, 2,5-dimethyl-4-nitropyridin-1-ium-1-olate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
2,5-dimethyl-4-nitro-1-oxidopyridin-1-ium (CAS 21816-42-2) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2,5-dimethyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: GVGSFHVUBRWBJT-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2,5-dimethyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | GVGSFHVUBRWBJT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=[N+]1[O-])C)[N+](=O)[O-] |
Computed by PubChem (NCBI)