Products 21816-42-2

CAS 21816-42-2 appears in our catalog under these names: 2,5-Dimethyl-4-nitropyridine 1-oxide, 95%, 2,5–Dimethyl–4–nitropyridine 1–oxide, 2,5-dimethyl-4-nitropyridin-1-ium-1-olate. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,5-dimethyl-4-nitro-1-oxidopyridin-1-ium (CAS 21816-42-2) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2,5-dimethyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: GVGSFHVUBRWBJT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O3
Molecular weight168.15 g/mol
IUPAC name2,5-dimethyl-4-nitro-1-oxidopyridin-1-ium
InChIKeyGVGSFHVUBRWBJT-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=[N+]1[O-])C)[N+](=O)[O-]

Computed by PubChem (NCBI)