CAS 218438-53-0 is the registry number for 5-((1E)-2-Phenylethenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(E)-2-phenylethenyl]-1,2-dihydro-1,2,4-triazole-3-thione (CAS 218438-53-0) is a chemical compound with the molecular formula C10H9N3S and a molecular weight of 203.27 g/mol. IUPAC name: 5-[(E)-2-phenylethenyl]-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: ALHGVKAIXXQXJE-VOTSOKGWSA-N.
| Molecular formula | C10H9N3S |
|---|---|
| Molecular weight | 203.27 g/mol |
| IUPAC name | 5-[(E)-2-phenylethenyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | ALHGVKAIXXQXJE-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=NC(=S)NN2 |
Computed by PubChem (NCBI)