CAS 21854-95-5 appears in our catalog under these names: 2,2'-Dichlorobenzil, 98%, 1,2-Bis(2-chlorophenyl)ethane-1,2-dione, 98+%, 2,2′–Dichlorobenzil, 2,2'-Dichlorobenzil, 98+% , 2,2'-DICHLORBENZIL, 97%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 5g, 25g, 1g, on request.
1,2-bis(2-chlorophenyl)ethane-1,2-dione (CAS 21854-95-5) is a chemical compound with the molecular formula C14H8Cl2O2 and a molecular weight of 279.1 g/mol. IUPAC name: 1,2-bis(2-chlorophenyl)ethane-1,2-dione. InChIKey: VOSNNSVWVJFJCR-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O2 |
|---|---|
| Molecular weight | 279.1 g/mol |
| IUPAC name | 1,2-bis(2-chlorophenyl)ethane-1,2-dione |
| InChIKey | VOSNNSVWVJFJCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(=O)C2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)