CAS 3457-46-3 appears in our catalog under these names: 4,4'-Dichlorobenzil, 98%, 4,4'–Dichlorobenzil, 4,4'-Dichlorobenzil, >98.0%(GC), 1,2-bis(4-chlorophenyl)ethane-1,2-dione, 98%, 98%, 1,2-Bis(4-chlorophenyl)ethane-1,2-dione, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100g, 25g, 5g.
1,2-bis(4-chlorophenyl)ethane-1,2-dione (CAS 3457-46-3) is a chemical compound with the molecular formula C14H8Cl2O2 and a molecular weight of 279.1 g/mol. IUPAC name: 1,2-bis(4-chlorophenyl)ethane-1,2-dione. InChIKey: XMAWUPHYEABFDR-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O2 |
|---|---|
| Molecular weight | 279.1 g/mol |
| IUPAC name | 1,2-bis(4-chlorophenyl)ethane-1,2-dione |
| InChIKey | XMAWUPHYEABFDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)