CAS 2351-37-3 appears in our catalog under these names: 4,4'-Biphenyldicarbonyl chloride, 95%, 4,4'–Biphenyldicarbonyl Chloride, 4,4'-Biphenyldicarbonyl chloride, 4,4'-Biphenyldicarbonyl Chloride, >97.0%(GC)(T), [1,1'-Biphenyl]-4,4'-dicarbonyl dichloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 2g, 100g.
4-(4-carbonochloridoylphenyl)benzoyl chloride (CAS 2351-37-3) is a chemical compound with the molecular formula C14H8Cl2O2 and a molecular weight of 279.1 g/mol. IUPAC name: 4-(4-carbonochloridoylphenyl)benzoyl chloride. InChIKey: QDBOAKPEXMMQFO-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O2 |
|---|---|
| Molecular weight | 279.1 g/mol |
| IUPAC name | 4-(4-carbonochloridoylphenyl)benzoyl chloride |
| InChIKey | QDBOAKPEXMMQFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(=O)Cl)C(=O)Cl |
Computed by PubChem (NCBI)