CAS 218608-93-6 appears in our catalog under these names: Boc–2–chloro–D–beta–homophenylalanine, BOC-(R)-3-AMINO-4-(2-CHLOROPHENYL)-BUTYRIC ACID, 98%, 98%, (R)-N-Boc-3-Amino-4-(2-chlorophenyl)butanoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(3R)-4-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 218608-93-6) is a chemical compound with the molecular formula C15H20ClNO4 and a molecular weight of 313.77 g/mol. IUPAC name: (3R)-4-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: UBRPCCFLMVZEKN-LLVKDONJSA-N.
| Molecular formula | C15H20ClNO4 |
|---|---|
| Molecular weight | 313.77 g/mol |
| IUPAC name | (3R)-4-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | UBRPCCFLMVZEKN-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1Cl)CC(=O)O |
Computed by PubChem (NCBI)