Products 21863-51-4
CAS 21863-51-4 appears in our catalog under these names: 6-Methylquinoline-8-sulfonyl chloride, 95%, 6-Methyl-8-quinoxalinesulfonyl Chloride, 6-Methylquinoline-8-sulfonyl chloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 250mg, 2,5g, 2g.
6-methylquinoline-8-sulfonyl chloride (CAS 21863-51-4) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: 6-methylquinoline-8-sulfonyl chloride. InChIKey: JZXUJBAZGSPYJP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 6-methylquinoline-8-sulfonyl chloride |
| InChIKey | JZXUJBAZGSPYJP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)S(=O)(=O)Cl)N=CC=C2 |
Computed by PubChem (NCBI)