CAS 2187426-62-4 is the registry number for [(3S,4S)-4-aminotetrahydrofuran-3-yl]methanol,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(3S,4S)-4-aminooxolan-3-yl]methanol;hydrochloride (CAS 2187426-62-4) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: [(3S,4S)-4-aminooxolan-3-yl]methanol;hydrochloride. InChIKey: WVYWTAAODGPTHO-UYXJWNHNSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | [(3S,4S)-4-aminooxolan-3-yl]methanol;hydrochloride |
| InChIKey | WVYWTAAODGPTHO-UYXJWNHNSA-N |
| SMILES | C1[C@@H]([C@@H](CO1)N)CO.Cl |
Computed by PubChem (NCBI)