Products 2307738-94-7
CAS 2307738-94-7 appears in our catalog under these names: rel-((3R,4R)-4-Aminotetrahydrofuran-3-yl)methanol hydrochloride, 97%, 97%, rel-((3R,4R)-4-Aminotetrahydrofuran-3-yl)methanol hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[(3R,4R)-4-aminooxolan-3-yl]methanol;hydrochloride (CAS 2307738-94-7) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: [(3R,4R)-4-aminooxolan-3-yl]methanol;hydrochloride. InChIKey: WVYWTAAODGPTHO-JBUOLDKXSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | [(3R,4R)-4-aminooxolan-3-yl]methanol;hydrochloride |
| InChIKey | WVYWTAAODGPTHO-JBUOLDKXSA-N |
| SMILES | C1[C@H]([C@H](CO1)N)CO.Cl |
Computed by PubChem (NCBI)