Products 218780-16-6
CAS 218780-16-6 is the registry number for (+)-12α-Hydroxyisodrimenin. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
(3S,5aS,9aS)-3-hydroxy-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-3H-benzo[g][2]benzofuran-1-one (CAS 218780-16-6) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: (3S,5aS,9aS)-3-hydroxy-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-3H-benzo[g][2]benzofuran-1-one. InChIKey: QQRBWENXGSIZJM-WBIUFABUSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | (3S,5aS,9aS)-3-hydroxy-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-3H-benzo[g][2]benzofuran-1-one |
| InChIKey | QQRBWENXGSIZJM-WBIUFABUSA-N |
| SMILES | C[C@]12CCCC([C@@H]1CCC3=C2C(=O)O[C@@H]3O)(C)C |
Computed by PubChem (NCBI)