CAS 21900-30-1 appears in our catalog under these names: Imatinib Impurity 29, 3-Chloro-4-methylbenzoyl Chloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
3-chloro-4-methylbenzoyl chloride (CAS 21900-30-1) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: 3-chloro-4-methylbenzoyl chloride. InChIKey: GANDSBWEBNXLMG-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | 3-chloro-4-methylbenzoyl chloride |
| InChIKey | GANDSBWEBNXLMG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)Cl)Cl |
Computed by PubChem (NCBI)