CAS 2191433-23-3 appears in our catalog under these names: 5-Cyclopropyl-3-(2-(trifluoromethoxy)phenyl)isoxazole-4-carboxylic acid, 96%, 5-Cyclopropyl-3-(2-(trifluoromethoxy)phenyl)isoxazole-4-carboxylic acid, 96%, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxylic acid (CAS 2191433-23-3) is a chemical compound with the molecular formula C14H10F3NO4 and a molecular weight of 313.23 g/mol. IUPAC name: 5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxylic acid. InChIKey: OGQCHFZTRPZSKF-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO4 |
|---|---|
| Molecular weight | 313.23 g/mol |
| IUPAC name | 5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxylic acid |
| InChIKey | OGQCHFZTRPZSKF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=NO2)C3=CC=CC=C3OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)