CAS 2918911-62-1 is the registry number for 4-methoxy-2-nitro-4'-(trifluoromethoxy)-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methoxy-2-nitro-1-[4-(trifluoromethoxy)phenyl]benzene (CAS 2918911-62-1) is a chemical compound with the molecular formula C14H10F3NO4 and a molecular weight of 313.23 g/mol. IUPAC name: 4-methoxy-2-nitro-1-[4-(trifluoromethoxy)phenyl]benzene. InChIKey: UCAMPCVHWQFANS-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO4 |
|---|---|
| Molecular weight | 313.23 g/mol |
| IUPAC name | 4-methoxy-2-nitro-1-[4-(trifluoromethoxy)phenyl]benzene |
| InChIKey | UCAMPCVHWQFANS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=CC=C(C=C2)OC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)