Products 1996-69-6
CAS 1996-69-6 is the registry number for 4-(4-Methoxyphenoxy)-3-nitrobenzotrifluoride, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
1-(4-methoxyphenoxy)-2-nitro-4-(trifluoromethyl)benzene (CAS 1996-69-6) is a chemical compound with the molecular formula C14H10F3NO4 and a molecular weight of 313.23 g/mol. IUPAC name: 1-(4-methoxyphenoxy)-2-nitro-4-(trifluoromethyl)benzene. InChIKey: WJNPONNEXMSLPF-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO4 |
|---|---|
| Molecular weight | 313.23 g/mol |
| IUPAC name | 1-(4-methoxyphenoxy)-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | WJNPONNEXMSLPF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)