Products 219298-74-5
CAS 219298-74-5 is the registry number for 2-Hydroxy-3,4,5,6-tetramethoxychalcone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(E)-3-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-1-phenylprop-2-en-1-one (CAS 219298-74-5) is a chemical compound with the molecular formula C19H20O6 and a molecular weight of 344.4 g/mol. IUPAC name: (E)-3-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-1-phenylprop-2-en-1-one. InChIKey: WKHFCYYMOLJMDZ-ZHACJKMWSA-N.
| Molecular formula | C19H20O6 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (E)-3-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)-1-phenylprop-2-en-1-one |
| InChIKey | WKHFCYYMOLJMDZ-ZHACJKMWSA-N |
| SMILES | COC1=C(C(=C(C(=C1/C=C/C(=O)C2=CC=CC=C2)O)OC)OC)OC |
Computed by PubChem (NCBI)