Products 2193065-18-6

CAS 2193065-18-6 is the registry number for Ethyl 2-((4-aminocyclohexyl)oxy)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-aminocyclohexyl)oxyacetate;hydrochloride (CAS 2193065-18-6) is a chemical compound with the molecular formula C10H20ClNO3 and a molecular weight of 237.72 g/mol. IUPAC name: ethyl 2-(4-aminocyclohexyl)oxyacetate;hydrochloride. InChIKey: DEFPSPHLKMZSNM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO3
Molecular weight237.72 g/mol
IUPAC nameethyl 2-(4-aminocyclohexyl)oxyacetate;hydrochloride
InChIKeyDEFPSPHLKMZSNM-UHFFFAOYSA-N
SMILESCCOC(=O)COC1CCC(CC1)N.Cl

Computed by PubChem (NCBI)