Products 2194550-41-7
CAS 2194550-41-7 is the registry number for 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine (CAS 2194550-41-7) is a chemical compound with the molecular formula C13H21BN2O3 and a molecular weight of 264.13 g/mol. IUPAC name: 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine. InChIKey: UIGAPINFOJLQPO-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O3 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine |
| InChIKey | UIGAPINFOJLQPO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OCC)N |
Computed by PubChem (NCBI)