CAS 219686-43-8 appears in our catalog under these names: 7–Bromo–4,5–dihydro–1H–benzo(b)(1,4)diazepin–2(3H)–one, 7-Bromo-4,5-dihydro-1H-benzo[b][1,4]diazepin-2(3H)-one, 97%, 97%, 7-Bromo-4,5-dihydro-1H-benzo[b][1,4]diazepin-2(3H)-one, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 250mg, 1g, 5g, 100mg, 10g.
7-bromo-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (CAS 219686-43-8) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one. InChIKey: JFCIBVBVEVBLKR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| InChIKey | JFCIBVBVEVBLKR-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=CC(=C2)Br)NC1=O |
Computed by PubChem (NCBI)