CAS 21969-11-9 appears in our catalog under these names: (4-Chlorophenyl)(4-nitrophenyl)sulfane, 98%+, 98%+, 4-Chloro-4'-nitrodiphenyl Sulfide, 98%+,RG. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
1-(4-chlorophenyl)sulfanyl-4-nitrobenzene (CAS 21969-11-9) is a chemical compound with the molecular formula C12H8ClNO2S and a molecular weight of 265.72 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfanyl-4-nitrobenzene. InChIKey: CPUBRDUBQIVBGM-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2S |
|---|---|
| Molecular weight | 265.72 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfanyl-4-nitrobenzene |
| InChIKey | CPUBRDUBQIVBGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])SC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)