CAS 445218-64-4 appears in our catalog under these names: 2-((2-Chlorophenyl)thio)nicotinic acid, 95%, 2-[(2-chlorophenyl)sulfanyl]pyridine-3-carboxylic acid, 95%, 95%, 2-[(2-chlorophenyl)sulfanyl]pyridine-3-carboxylic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-(2-chlorophenyl)sulfanylpyridine-3-carboxylic acid (CAS 445218-64-4) is a chemical compound with the molecular formula C12H8ClNO2S and a molecular weight of 265.72 g/mol. IUPAC name: 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylic acid. InChIKey: YMCMJFXYOSGRJU-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2S |
|---|---|
| Molecular weight | 265.72 g/mol |
| IUPAC name | 2-(2-chlorophenyl)sulfanylpyridine-3-carboxylic acid |
| InChIKey | YMCMJFXYOSGRJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)SC2=C(C=CC=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)