CAS 4548-56-5 is the registry number for (4-Chloro-2-nitrophenyl)(phenyl)sulfane, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
4-chloro-2-nitro-1-phenylsulfanylbenzene (CAS 4548-56-5) is a chemical compound with the molecular formula C12H8ClNO2S and a molecular weight of 265.72 g/mol. IUPAC name: 4-chloro-2-nitro-1-phenylsulfanylbenzene. InChIKey: GSQPMKQJTMHIFH-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2S |
|---|---|
| Molecular weight | 265.72 g/mol |
| IUPAC name | 4-chloro-2-nitro-1-phenylsulfanylbenzene |
| InChIKey | GSQPMKQJTMHIFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)