CAS 219701-50-5 appears in our catalog under these names: (S)-(Tetrahydro-2h-pyran-3-yl)methyl benzoate, 95%, (S)-(Tetrahydro-2H-pyran-3-yl)methyl benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
[(3S)-oxan-3-yl]methyl benzoate (CAS 219701-50-5) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: [(3S)-oxan-3-yl]methyl benzoate. InChIKey: WENZOXDGFQZGOW-NSHDSACASA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | [(3S)-oxan-3-yl]methyl benzoate |
| InChIKey | WENZOXDGFQZGOW-NSHDSACASA-N |
| SMILES | C1C[C@@H](COC1)COC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)