Products 219763-98-1
CAS 219763-98-1 is the registry number for Methyl 2-methyl-3H-imidazo[4,5-b]pyridine-5-carboxylate, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-methyl-1H-imidazo[4,5-b]pyridine-5-carboxylate (CAS 219763-98-1) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: methyl 2-methyl-1H-imidazo[4,5-b]pyridine-5-carboxylate. InChIKey: WCPBXFSDYCKAGR-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | methyl 2-methyl-1H-imidazo[4,5-b]pyridine-5-carboxylate |
| InChIKey | WCPBXFSDYCKAGR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=CC(=N2)C(=O)OC |
Computed by PubChem (NCBI)