Products 2198-93-8
CAS 2198-93-8 is the registry number for Trichodermol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2R,7R,9R,11R,12S)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-ol (CAS 2198-93-8) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: (1S,2R,7R,9R,11R,12S)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-ol. InChIKey: XSUVNTHNQMGPIL-LACSLYJWSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | (1S,2R,7R,9R,11R,12S)-1,2,5-trimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-11-ol |
| InChIKey | XSUVNTHNQMGPIL-LACSLYJWSA-N |
| SMILES | CC1=C[C@@H]2[C@](CC1)([C@]3([C@@H](C[C@H]([C@@]34CO4)O2)O)C)C |
Computed by PubChem (NCBI)