Products 2198312-11-5
CAS 2198312-11-5 appears in our catalog under these names: (R)-1-(tert-Butoxycarbonyl)-3-fluoropiperidine-3-carboxylic acid, 98%, (3R)-1-[(tert-butoxy)carbonyl]-3-fluoropiperidine-3-carboxylic acid, >97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
(3R)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 2198312-11-5) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: (3R)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: BUOPUFGUVSXFRG-LLVKDONJSA-N.
| Molecular formula | C11H18FNO4 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | (3R)-3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | BUOPUFGUVSXFRG-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](C1)(C(=O)O)F |
Computed by PubChem (NCBI)