CAS 2199-91-9 appears in our catalog under these names: 3-Acetyl-6,8-dichloro-2h-chromen-2-one, 95%, 3-acetyl-6,8-dichloro-2H-chromen-2-one. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
3-acetyl-6,8-dichlorochromen-2-one (CAS 2199-91-9) is a chemical compound with the molecular formula C11H6Cl2O3 and a molecular weight of 257.07 g/mol. IUPAC name: 3-acetyl-6,8-dichlorochromen-2-one. InChIKey: HCEPIRHGFPRDGG-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2O3 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 3-acetyl-6,8-dichlorochromen-2-one |
| InChIKey | HCEPIRHGFPRDGG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=CC(=CC(=C2OC1=O)Cl)Cl |
Computed by PubChem (NCBI)