CAS 55462-54-9 appears in our catalog under these names: 5-(2,3-Dichlorophenyl)-2-furoic acid, 95%, 5-(2,3-Dichlorophenyl)furan-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g.
5-(2,3-dichlorophenyl)furan-2-carboxylic acid (CAS 55462-54-9) is a chemical compound with the molecular formula C11H6Cl2O3 and a molecular weight of 257.07 g/mol. IUPAC name: 5-(2,3-dichlorophenyl)furan-2-carboxylic acid. InChIKey: BSMKDXIJGSTBNT-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2O3 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 5-(2,3-dichlorophenyl)furan-2-carboxylic acid |
| InChIKey | BSMKDXIJGSTBNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)