CAS 54023-01-7 is the registry number for 5-(3,4-Dichlorophenyl)-2-furoic Acid. Offered by: TRC. Available pack sizes: 10g.
5-(3,4-dichlorophenyl)furan-2-carboxylic acid (CAS 54023-01-7) is a chemical compound with the molecular formula C11H6Cl2O3 and a molecular weight of 257.07 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)furan-2-carboxylic acid. InChIKey: GNXLBNMHCYYSPU-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2O3 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)furan-2-carboxylic acid |
| InChIKey | GNXLBNMHCYYSPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=C(O2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)