Products 219915-41-0
CAS 219915-41-0 is the registry number for Ozagrel Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[4-(hydroxymethyl)phenyl]prop-2-enoic acid (CAS 219915-41-0) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (E)-3-[4-(hydroxymethyl)phenyl]prop-2-enoic acid. InChIKey: WBVWJXSDIOLYPW-AATRIKPKSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (E)-3-[4-(hydroxymethyl)phenyl]prop-2-enoic acid |
| InChIKey | WBVWJXSDIOLYPW-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1CO)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Hydroxymethyl)cinnamic acid, Ozagrel impurity vi, Ozagrel Impurity 31, (E)-3-[4-(hydroxymethyl)phenyl]prop-2-enoic acid, (E)-3-(4-(hydroxymethyl)phenyl)acrylic acid, (2E)-3-[4-(Hydroxymethyl)phenyl]-2-propenoic acid, 2-Propenoic acid, 3-[4-(hydroxymethyl)phenyl]-, (2E)-, Ozagrelimpurityvi, 4-(hydroxymethyl)cinnamicacid