Products 2199213-86-8
CAS 2199213-86-8 is the registry number for 1-(tert-Butyl) 3-methyl (R)-3-methylpyrrolidine-1,3-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 3-O-methyl (3R)-3-methylpyrrolidine-1,3-dicarboxylate (CAS 2199213-86-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R)-3-methylpyrrolidine-1,3-dicarboxylate. InChIKey: AUABPENEDJXJQH-GFCCVEGCSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R)-3-methylpyrrolidine-1,3-dicarboxylate |
| InChIKey | AUABPENEDJXJQH-GFCCVEGCSA-N |
| SMILES | C[C@]1(CCN(C1)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)