CAS 220001-82-1 appears in our catalog under these names: 5H,6H,7H-cyclopenta(b)pyridine-6-carboxylic acid hydrochloride, 95%, 5H,6H,7H-Cyclopenta(b)pyridine-6-carboxylic acid hydrochloride, 5H,6H,7H-cyclopenta[b]pyridine-6-carboxylic acid hydrochloride, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 0,5g, 50mg, 100mg, 250mg, 500mg.
6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylic acid;hydrochloride (CAS 220001-82-1) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylic acid;hydrochloride. InChIKey: VGYXEASWAXBWEH-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylic acid;hydrochloride |
| InChIKey | VGYXEASWAXBWEH-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)