CAS 2200278-74-4 appears in our catalog under these names: (6S)-5-Azaspiro[2.4]heptane-6-carboxylic acid hydrochloride, 95%, (S)-5-Azaspiro(2.4)heptane-6-carboxylic acid hydrochloride, 97%, (6S)-5-azaspiro[2.4]heptane-6-carboxylic acid hydrochloride, 97%, 97%, (S)-5-Azaspiro[2.4]heptane-6-carboxylic acid HCl, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 1g, 5g.
(6S)-5-azaspiro[2.4]heptane-6-carboxylic acid;hydrochloride (CAS 2200278-74-4) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (6S)-5-azaspiro[2.4]heptane-6-carboxylic acid;hydrochloride. InChIKey: BRRSGWFCZURAAE-JEDNCBNOSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (6S)-5-azaspiro[2.4]heptane-6-carboxylic acid;hydrochloride |
| InChIKey | BRRSGWFCZURAAE-JEDNCBNOSA-N |
| SMILES | C1CC12C[C@H](NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)