CAS 220060-17-3 appears in our catalog under these names: (S)-N-Boc-2-methylproline methyl ester, 95%, (S)-N-Boc-2-methylproline methyl ester, 97%, (S)-N-Boc-2-methylproline methyl ester, 97%, 97%, 1-tert-Butyl 2-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 500mg.
1-O-tert-butyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate (CAS 220060-17-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate. InChIKey: KXFNLDIOHLDSJA-LBPRGKRZSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-2-methylpyrrolidine-1,2-dicarboxylate |
| InChIKey | KXFNLDIOHLDSJA-LBPRGKRZSA-N |
| SMILES | C[C@]1(CCCN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)