CAS 220099-89-8 is the registry number for 6',7'-Dihydro-3'H-4-azaspiro[bicyclo[2.2.2]octane-2,2'-furo[2,3-b]pyridine], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine] (CAS 220099-89-8) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]. InChIKey: OCKIPDMKGPYYJS-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine] |
| InChIKey | OCKIPDMKGPYYJS-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C3(C2)CC4=C(O3)N=CC=C4 |
Computed by PubChem (NCBI)