CAS 220099-91-2 appears in our catalog under these names: (2R)-3H-1'-Azaspiro[furo[2,3-b]pyridine-2,3'-bicyclo[2.2.2]octane], 97+%, AZD0328. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine] (CAS 220099-91-2) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: (3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]. InChIKey: OCKIPDMKGPYYJS-ZDUSSCGKSA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | (3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine] |
| InChIKey | OCKIPDMKGPYYJS-ZDUSSCGKSA-N |
| SMILES | C1CN2CCC1[C@@]3(C2)CC4=C(O3)N=CC=C4 |
Computed by PubChem (NCBI)