CAS 220141-69-5 appears in our catalog under these names: 2',4',6'-Trifluoropropiophenone, 97%, 1-(2,4,6-Trifluorophenyl)-1-Propanone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
1-(2,4,6-trifluorophenyl)propan-1-one (CAS 220141-69-5) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 1-(2,4,6-trifluorophenyl)propan-1-one. InChIKey: XUIWCYLHECDQQL-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 1-(2,4,6-trifluorophenyl)propan-1-one |
| InChIKey | XUIWCYLHECDQQL-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1F)F)F |
Computed by PubChem (NCBI)