Products 220220-19-9
CAS 220220-19-9 appears in our catalog under these names: 1-(2-Chloro-4-nitrophenyl)-1,4-diazepane, 95%, 1-(2-Chloro-4-nitrophenyl)homopiperazine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
1-(2-chloro-4-nitrophenyl)-1,4-diazepane (CAS 220220-19-9) is a chemical compound with the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. IUPAC name: 1-(2-chloro-4-nitrophenyl)-1,4-diazepane. InChIKey: MVZOFBIWSFBCKA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 1-(2-chloro-4-nitrophenyl)-1,4-diazepane |
| InChIKey | MVZOFBIWSFBCKA-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)