CAS 392710-17-7 appears in our catalog under these names: 1-(2-Chloro-4-nitrophenyl)-3-methylpiperazine, 97%, 1-(2-Chloro-4-nitrophenyl)-3-methylpiperazine hydrochloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
1-(2-chloro-4-nitrophenyl)-3-methylpiperazine (CAS 392710-17-7) is a chemical compound with the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. IUPAC name: 1-(2-chloro-4-nitrophenyl)-3-methylpiperazine. InChIKey: CNROPYCGZCFWJI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 1-(2-chloro-4-nitrophenyl)-3-methylpiperazine |
| InChIKey | CNROPYCGZCFWJI-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)