CAS 443923-21-5 is the registry number for 1-(4-Chloro-2-nitrophenyl)-1,4-diazepane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-(4-chloro-2-nitrophenyl)-1,4-diazepane (CAS 443923-21-5) is a chemical compound with the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. IUPAC name: 1-(4-chloro-2-nitrophenyl)-1,4-diazepane. InChIKey: KLZCNMVBZDWQIE-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O2 |
|---|---|
| Molecular weight | 255.70 g/mol |
| IUPAC name | 1-(4-chloro-2-nitrophenyl)-1,4-diazepane |
| InChIKey | KLZCNMVBZDWQIE-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)