Products 2203717-19-3
CAS 2203717-19-3 is the registry number for N,N-Diethyl-5-iodo-2-methyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N,N-diethyl-5-iodo-2-methylbenzamide (CAS 2203717-19-3) is a chemical compound with the molecular formula C12H16INO and a molecular weight of 317.17 g/mol. IUPAC name: N,N-diethyl-5-iodo-2-methylbenzamide. InChIKey: PHMXHIPXGWVETC-UHFFFAOYSA-N.
| Molecular formula | C12H16INO |
|---|---|
| Molecular weight | 317.17 g/mol |
| IUPAC name | N,N-diethyl-5-iodo-2-methylbenzamide |
| InChIKey | PHMXHIPXGWVETC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=CC(=C1)I)C |
Computed by PubChem (NCBI)