CAS 59223-23-3 appears in our catalog under these names: 5–Hydroxy–1,2,3,3–tetramethyl–3H–indol–1–ium iodide, 5-Hydroxy-1,2,3,3-tetramethyl-3H-indol-1-ium iodide 97%, 3H-Indolium, 5-hydroxy-1,2,3,3-tetramethyl-, iodide, 97%, 97%, 5-Hydroxy-1,2,3,3-tetramethyl-3H-indol-1-ium iodide, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
1,2,3,3-tetramethylindol-1-ium-5-ol iodide (CAS 59223-23-3) is a chemical compound with the molecular formula C12H16INO and a molecular weight of 317.17 g/mol. IUPAC name: 1,2,3,3-tetramethylindol-1-ium-5-ol iodide. InChIKey: QSSOQZGDUDZIAO-UHFFFAOYSA-N.
| Molecular formula | C12H16INO |
|---|---|
| Molecular weight | 317.17 g/mol |
| IUPAC name | 1,2,3,3-tetramethylindol-1-ium-5-ol iodide |
| InChIKey | QSSOQZGDUDZIAO-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C2=C(C1(C)C)C=C(C=C2)O)C.[I-] |
Computed by PubChem (NCBI)