CAS 435282-59-0 is the registry number for N-(3-Iodophenyl)-3,3-dimethylbutanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-iodophenyl)-3,3-dimethylbutanamide (CAS 435282-59-0) is a chemical compound with the molecular formula C12H16INO and a molecular weight of 317.17 g/mol. IUPAC name: N-(3-iodophenyl)-3,3-dimethylbutanamide. InChIKey: XJUOCVNNGHRKSL-UHFFFAOYSA-N.
| Molecular formula | C12H16INO |
|---|---|
| Molecular weight | 317.17 g/mol |
| IUPAC name | N-(3-iodophenyl)-3,3-dimethylbutanamide |
| InChIKey | XJUOCVNNGHRKSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)NC1=CC(=CC=C1)I |
Computed by PubChem (NCBI)