CAS 220493-83-4 appears in our catalog under these names: 2-([(tert-Butoxy)carbonyl](ethyl)amino)propanoic acid, 95%, 2-{((tert-butoxy)carbonyl)(ethyl)amino}propanoic acid, 95%, 2-{((tert-butoxy)carbonyl)(ethyl)amino}propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 220493-83-4) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: 2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: GFJATYWLXLZSCZ-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | GFJATYWLXLZSCZ-UHFFFAOYSA-N |
| SMILES | CCN(C(C)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)