CAS 91292-56-7 is the registry number for (S)-2-((tert-Butoxycarbonyl)(ethyl)amino)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 91292-56-7) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (2S)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: GFJATYWLXLZSCZ-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (2S)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | GFJATYWLXLZSCZ-ZETCQYMHSA-N |
| SMILES | CCN([C@@H](C)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)