CAS 220499-20-7 appears in our catalog under these names: (2S)–2–Amino–3–(1H–indol–4–yl)propanoic acid, H-Ala(1H-indol-4-yl)-OH, 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 1g.
(2S)-2-amino-3-(1H-indol-4-yl)propanoic acid (CAS 220499-20-7) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: (2S)-2-amino-3-(1H-indol-4-yl)propanoic acid. InChIKey: DSEIRMIVNPCUSR-VIFPVBQESA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S)-2-amino-3-(1H-indol-4-yl)propanoic acid |
| InChIKey | DSEIRMIVNPCUSR-VIFPVBQESA-N |
| SMILES | C1=CC(=C2C=CNC2=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)