CAS 220512-86-7 is the registry number for Teriflunomide Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-cyano-3-hydroxy-N-[2-(trifluoromethyl)phenyl]but-2-enamide (CAS 220512-86-7) is a chemical compound with the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. IUPAC name: 2-cyano-3-hydroxy-N-[2-(trifluoromethyl)phenyl]but-2-enamide. InChIKey: GGBCNCVXXKRIRI-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2 |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | 2-cyano-3-hydroxy-N-[2-(trifluoromethyl)phenyl]but-2-enamide |
| InChIKey | GGBCNCVXXKRIRI-UHFFFAOYSA-N |
| SMILES | CC(=C(C#N)C(=O)NC1=CC=CC=C1C(F)(F)F)O |
Computed by PubChem (NCBI)