CAS 220526-76-1 appears in our catalog under these names: (5-Chlorobenzofuran-2-yl)(4-methoxyphenyl)methanone, 95%, (5–Chlorobenzofuran–2–yl)(4–methoxyphenyl)methanone, (5-Chloro-1-benzofuran-2-yl)(4-methoxyphenyl)methanone. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg.
(5-chloro-1-benzofuran-2-yl)-(4-methoxyphenyl)methanone (CAS 220526-76-1) is a chemical compound with the molecular formula C16H11ClO3 and a molecular weight of 286.71 g/mol. IUPAC name: (5-chloro-1-benzofuran-2-yl)-(4-methoxyphenyl)methanone. InChIKey: AACRMSQFZNENME-UHFFFAOYSA-N.
| Molecular formula | C16H11ClO3 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | (5-chloro-1-benzofuran-2-yl)-(4-methoxyphenyl)methanone |
| InChIKey | AACRMSQFZNENME-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)